C19H20ClNO5S — CID 7823612
[2-oxo-2-(4-propylphenyl)ethyl] 4-chloro-3-(methylsulfamoyl)benzoate (PubChem CID 7823612) has the molecular formula C19H20ClNO5S and a molecular weight of 409.89 g/mol. Its IUPAC name is [2-oxo-2-(4-propylphenyl)ethyl] 4-chloro-3-(methylsulfamoyl)benzoate.
| Compound Name | [2-oxo-2-(4-propylphenyl)ethyl] 4-chloro-3-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7823612 |
| Molecular Formula | C19H20ClNO5S |
| Molecular Weight | 409.89 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | [2-oxo-2-(4-propylphenyl)ethyl] 4-chloro-3-(methylsulfamoyl)benzoate |
| SMILES | CCCc1ccc(C(=O)COC(=O)c2ccc(Cl)c(S(=O)(=O)NC)c2)cc1 |
| InChI | InChI=1S/C19H20ClNO5S/c1-3-4-13-5-7-14(8-6-13)17(22)12-26-19(23)15-9-10-16(20)18(11-15)27(24,25)21-2/h5-11,21H,3-4,12H2,1-2H3 |
| InChIKey | CVSRHDNVZAJPBH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.89 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |