C11H11Cl2NO4S — CID 27027293
2-chloroprop-2-enyl 4-chloro-3-(methylsulfamoyl)benzoate (PubChem CID 27027293) has the molecular formula C11H11Cl2NO4S and a molecular weight of 324.19 g/mol. Its IUPAC name is 2-chloroprop-2-enyl 4-chloro-3-(methylsulfamoyl)benzoate.
| Compound Name | 2-chloroprop-2-enyl 4-chloro-3-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 27027293 |
| Molecular Formula | C11H11Cl2NO4S |
| Molecular Weight | 324.19 g/mol |
| Exact Mass | 322.98 |
| IUPAC Name | 2-chloroprop-2-enyl 4-chloro-3-(methylsulfamoyl)benzoate |
| SMILES | C=C(Cl)COC(=O)c1ccc(Cl)c(S(=O)(=O)NC)c1 |
| InChI | InChI=1S/C11H11Cl2NO4S/c1-7(12)6-18-11(15)8-3-4-9(13)10(5-8)19(16,17)14-2/h3-5,14H,1,6H2,2H3 |
| InChIKey | DRKYRJASMIOLOD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.19 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |