C16H14ClFN2O5S — CID 7823723
[2-(4-fluoroanilino)-2-oxoethyl] 4-chloro-3-(methylsulfamoyl)benzoate (PubChem CID 7823723) has the molecular formula C16H14ClFN2O5S and a molecular weight of 400.82 g/mol. Its IUPAC name is [2-(4-fluoroanilino)-2-oxoethyl] 4-chloro-3-(methylsulfamoyl)benzoate.
| Compound Name | [2-(4-fluoroanilino)-2-oxoethyl] 4-chloro-3-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7823723 |
| Molecular Formula | C16H14ClFN2O5S |
| Molecular Weight | 400.82 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | [2-(4-fluoroanilino)-2-oxoethyl] 4-chloro-3-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1cc(C(=O)OCC(=O)Nc2ccc(F)cc2)ccc1Cl |
| InChI | InChI=1S/C16H14ClFN2O5S/c1-19-26(23,24)14-8-10(2-7-13(14)17)16(22)25-9-15(21)20-12-5-3-11(18)4-6-12/h2-8,19H,9H2,1H3,(H,20,21) |
| InChIKey | VSMPGINTANPNJJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.82 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |