C17H17ClN2O5S — CID 2615177
[2-(3,4-dimethylanilino)-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate (PubChem CID 2615177) has the molecular formula C17H17ClN2O5S and a molecular weight of 396.85 g/mol. Its IUPAC name is [2-(3,4-dimethylanilino)-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate.
| Compound Name | [2-(3,4-dimethylanilino)-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 2615177 |
| Molecular Formula | C17H17ClN2O5S |
| Molecular Weight | 396.85 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | [2-(3,4-dimethylanilino)-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)c2ccc(Cl)c(S(N)(=O)=O)c2)cc1C |
| InChI | InChI=1S/C17H17ClN2O5S/c1-10-3-5-13(7-11(10)2)20-16(21)9-25-17(22)12-4-6-14(18)15(8-12)26(19,23)24/h3-8H,9H2,1-2H3,(H,20,21)(H2,19,23,24) |
| InChIKey | XSMZKPYNKLIHQN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.85 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |