C21H23ClN2O6S — CID 16568897
[2-[4-(hexanoylamino)phenyl]-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate (PubChem CID 16568897) has the molecular formula C21H23ClN2O6S and a molecular weight of 466.94 g/mol. Its IUPAC name is [2-[4-(hexanoylamino)phenyl]-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate.
| Compound Name | [2-[4-(hexanoylamino)phenyl]-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 16568897 |
| Molecular Formula | C21H23ClN2O6S |
| Molecular Weight | 466.94 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | [2-[4-(hexanoylamino)phenyl]-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate |
| SMILES | CCCCCC(=O)Nc1ccc(C(=O)COC(=O)c2ccc(Cl)c(S(N)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C21H23ClN2O6S/c1-2-3-4-5-20(26)24-16-9-6-14(7-10-16)18(25)13-30-21(27)15-8-11-17(22)19(12-15)31(23,28)29/h6-12H,2-5,13H2,1H3,(H,24,26)(H2,23,28,29) |
| InChIKey | RNBFNISCOBVRDY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 132.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.94 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|