C20H22N2O4 — CID 7477362
[2-[4-(hexanoylamino)phenyl]-2-oxoethyl] pyridine-2-carboxylate (PubChem CID 7477362) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is [2-[4-(hexanoylamino)phenyl]-2-oxoethyl] pyridine-2-carboxylate.
| Compound Name | [2-[4-(hexanoylamino)phenyl]-2-oxoethyl] pyridine-2-carboxylate |
|---|---|
| PubChem CID | 7477362 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | [2-[4-(hexanoylamino)phenyl]-2-oxoethyl] pyridine-2-carboxylate |
| SMILES | CCCCCC(=O)Nc1ccc(C(=O)COC(=O)c2ccccn2)cc1 |
| InChI | InChI=1S/C20H22N2O4/c1-2-3-4-8-19(24)22-16-11-9-15(10-12-16)18(23)14-26-20(25)17-7-5-6-13-21-17/h5-7,9-13H,2-4,8,14H2,1H3,(H,22,24) |
| InChIKey | MPQSMBHQTKGQKY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|