C26H32N2O5 — CID 16564557
[2-[4-(hexanoylamino)phenyl]-2-oxoethyl] (2S)-2-benzamido-3-methylbutanoate (PubChem CID 16564557) has the molecular formula C26H32N2O5 and a molecular weight of 452.55 g/mol. Its IUPAC name is [2-[4-(hexanoylamino)phenyl]-2-oxoethyl] (2S)-2-benzamido-3-methylbutanoate.
| Compound Name | [2-[4-(hexanoylamino)phenyl]-2-oxoethyl] (2S)-2-benzamido-3-methylbutanoate |
|---|---|
| PubChem CID | 16564557 |
| Molecular Formula | C26H32N2O5 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | [2-[4-(hexanoylamino)phenyl]-2-oxoethyl] (2S)-2-benzamido-3-methylbutanoate |
| SMILES | CCCCCC(=O)Nc1ccc(C(=O)COC(=O)[C@@H](NC(=O)c2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C26H32N2O5/c1-4-5-7-12-23(30)27-21-15-13-19(14-16-21)22(29)17-33-26(32)24(18(2)3)28-25(31)20-10-8-6-9-11-20/h6,8-11,13-16,18,24H,4-5,7,12,17H2,1-3H3,(H,27,30)(H,28,31)/t24-/m0/s1 |
| InChIKey | WNXUSFCVDKFZCY-DEOSSOPVSA-N |
| XLogP | 4.39 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|