C26H34N4O4 — CID 16624894
[2-[4-(4-ethylpiperazin-1-yl)anilino]-2-oxoethyl] (2S)-2-benzamido-3-methylbutanoate (PubChem CID 16624894) has the molecular formula C26H34N4O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is [2-[4-(4-ethylpiperazin-1-yl)anilino]-2-oxoethyl] (2S)-2-benzamido-3-methylbutanoate.
| Compound Name | [2-[4-(4-ethylpiperazin-1-yl)anilino]-2-oxoethyl] (2S)-2-benzamido-3-methylbutanoate |
|---|---|
| PubChem CID | 16624894 |
| Molecular Formula | C26H34N4O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | [2-[4-(4-ethylpiperazin-1-yl)anilino]-2-oxoethyl] (2S)-2-benzamido-3-methylbutanoate |
| SMILES | CCN1CCN(c2ccc(NC(=O)COC(=O)[C@@H](NC(=O)c3ccccc3)C(C)C)cc2)CC1 |
| InChI | InChI=1S/C26H34N4O4/c1-4-29-14-16-30(17-15-29)22-12-10-21(11-13-22)27-23(31)18-34-26(33)24(19(2)3)28-25(32)20-8-6-5-7-9-20/h5-13,19,24H,4,14-18H2,1-3H3,(H,27,31)(H,28,32)/t24-/m0/s1 |
| InChIKey | JDMAYPWZDBSIHT-DEOSSOPVSA-N |
| XLogP | 2.76 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|