C21H24ClN3O3 — CID 16624569
[2-[4-(4-ethylpiperazin-1-yl)anilino]-2-oxoethyl] 4-chlorobenzoate (PubChem CID 16624569) has the molecular formula C21H24ClN3O3 and a molecular weight of 401.89 g/mol. Its IUPAC name is [2-[4-(4-ethylpiperazin-1-yl)anilino]-2-oxoethyl] 4-chlorobenzoate.
| Compound Name | [2-[4-(4-ethylpiperazin-1-yl)anilino]-2-oxoethyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 16624569 |
| Molecular Formula | C21H24ClN3O3 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | [2-[4-(4-ethylpiperazin-1-yl)anilino]-2-oxoethyl] 4-chlorobenzoate |
| SMILES | CCN1CCN(c2ccc(NC(=O)COC(=O)c3ccc(Cl)cc3)cc2)CC1 |
| InChI | InChI=1S/C21H24ClN3O3/c1-2-24-11-13-25(14-12-24)19-9-7-18(8-10-19)23-20(26)15-28-21(27)16-3-5-17(22)6-4-16/h3-10H,2,11-15H2,1H3,(H,23,26) |
| InChIKey | VQFCFXHEFVKZIQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|