C19H25Cl2N3O3 — CID 26288375
[2-[4-(4-ethylpiperazin-1-yl)anilino]-2-oxoethyl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate (PubChem CID 26288375) has the molecular formula C19H25Cl2N3O3 and a molecular weight of 414.33 g/mol. Its IUPAC name is [2-[4-(4-ethylpiperazin-1-yl)anilino]-2-oxoethyl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate.
| Compound Name | [2-[4-(4-ethylpiperazin-1-yl)anilino]-2-oxoethyl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 26288375 |
| Molecular Formula | C19H25Cl2N3O3 |
| Molecular Weight | 414.33 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | [2-[4-(4-ethylpiperazin-1-yl)anilino]-2-oxoethyl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| SMILES | CCN1CCN(c2ccc(NC(=O)COC(=O)[C@]3(C)CC3(Cl)Cl)cc2)CC1 |
| InChI | InChI=1S/C19H25Cl2N3O3/c1-3-23-8-10-24(11-9-23)15-6-4-14(5-7-15)22-16(25)12-27-17(26)18(2)13-19(18,20)21/h4-7H,3,8-13H2,1-2H3,(H,22,25)/t18-/m0/s1 |
| InChIKey | HTJMEVWFOVKBFY-SFHVURJKSA-N |
| XLogP | 2.89 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|