C20H26N4O4S — CID 146088437
N-[4-(4-ethylpiperazin-1-yl)phenyl]-2-(4-sulfamoylphenoxy)acetamide (PubChem CID 146088437) has the molecular formula C20H26N4O4S and a molecular weight of 418.52 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)phenyl]-2-(4-sulfamoylphenoxy)acetamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]-2-(4-sulfamoylphenoxy)acetamide |
|---|---|
| PubChem CID | 146088437 |
| Molecular Formula | C20H26N4O4S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]-2-(4-sulfamoylphenoxy)acetamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)COc3ccc(S(N)(=O)=O)cc3)cc2)CC1 |
| InChI | InChI=1S/C20H26N4O4S/c1-2-23-11-13-24(14-12-23)17-5-3-16(4-6-17)22-20(25)15-28-18-7-9-19(10-8-18)29(21,26)27/h3-10H,2,11-15H2,1H3,(H,22,25)(H2,21,26,27) |
| InChIKey | WLPPYERVJNKBLD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|