C20H20Cl2N2O3 — CID 7665105
[2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 3,5-dichlorobenzoate (PubChem CID 7665105) has the molecular formula C20H20Cl2N2O3 and a molecular weight of 407.30 g/mol. Its IUPAC name is [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 3,5-dichlorobenzoate.
| Compound Name | [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 7665105 |
| Molecular Formula | C20H20Cl2N2O3 |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 3,5-dichlorobenzoate |
| SMILES | O=C(COC(=O)c1cc(Cl)cc(Cl)c1)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H20Cl2N2O3/c21-15-10-14(11-16(22)12-15)20(26)27-13-19(25)23-17-4-6-18(7-5-17)24-8-2-1-3-9-24/h4-7,10-12H,1-3,8-9,13H2,(H,23,25) |
| InChIKey | SRIQRWQGXJGTKM-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|