C22H24N2O5 — CID 9201384
[2-[4-(azepan-1-yl)anilino]-2-oxoethyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 9201384) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is [2-[4-(azepan-1-yl)anilino]-2-oxoethyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [2-[4-(azepan-1-yl)anilino]-2-oxoethyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 9201384 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | [2-[4-(azepan-1-yl)anilino]-2-oxoethyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2c(c1)OCO2)Nc1ccc(N2CCCCCC2)cc1 |
| InChI | InChI=1S/C22H24N2O5/c25-21(14-27-22(26)16-5-10-19-20(13-16)29-15-28-19)23-17-6-8-18(9-7-17)24-11-3-1-2-4-12-24/h5-10,13H,1-4,11-12,14-15H2,(H,23,25) |
| InChIKey | QYOVKMNZGBAIMF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|