C21H22F2N2O3 — CID 9483570
[2-[4-(azepan-1-yl)anilino]-2-oxoethyl] 3,4-difluorobenzoate (PubChem CID 9483570) has the molecular formula C21H22F2N2O3 and a molecular weight of 388.41 g/mol. Its IUPAC name is [2-[4-(azepan-1-yl)anilino]-2-oxoethyl] 3,4-difluorobenzoate.
| Compound Name | [2-[4-(azepan-1-yl)anilino]-2-oxoethyl] 3,4-difluorobenzoate |
|---|---|
| PubChem CID | 9483570 |
| Molecular Formula | C21H22F2N2O3 |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | [2-[4-(azepan-1-yl)anilino]-2-oxoethyl] 3,4-difluorobenzoate |
| SMILES | O=C(COC(=O)c1ccc(F)c(F)c1)Nc1ccc(N2CCCCCC2)cc1 |
| InChI | InChI=1S/C21H22F2N2O3/c22-18-10-5-15(13-19(18)23)21(27)28-14-20(26)24-16-6-8-17(9-7-16)25-11-3-1-2-4-12-25/h5-10,13H,1-4,11-12,14H2,(H,24,26) |
| InChIKey | IYHZQBUKZFTWTG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|