C20H22N2O4 — CID 7378641
[2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 3-hydroxybenzoate (PubChem CID 7378641) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 3-hydroxybenzoate.
| Compound Name | [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 3-hydroxybenzoate |
|---|---|
| PubChem CID | 7378641 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 3-hydroxybenzoate |
| SMILES | O=C(COC(=O)c1cccc(O)c1)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H22N2O4/c23-18-6-4-5-15(13-18)20(25)26-14-19(24)21-16-7-9-17(10-8-16)22-11-2-1-3-12-22/h4-10,13,23H,1-3,11-12,14H2,(H,21,24) |
| InChIKey | MMSSFTVHFYTDLT-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|