C20H22N2O5 — CID 7870792
[2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 2,4-dihydroxybenzoate (PubChem CID 7870792) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 2,4-dihydroxybenzoate.
| Compound Name | [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 2,4-dihydroxybenzoate |
|---|---|
| PubChem CID | 7870792 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 2,4-dihydroxybenzoate |
| SMILES | O=C(COC(=O)c1ccc(O)cc1O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H22N2O5/c23-16-8-9-17(18(24)12-16)20(26)27-13-19(25)21-14-4-6-15(7-5-14)22-10-2-1-3-11-22/h4-9,12,23-24H,1-3,10-11,13H2,(H,21,25) |
| InChIKey | SEPLCFPTWRLURX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|