C14H17NO5 — CID 2537018
(2-oxo-2-piperidin-1-ylethyl) 2,4-dihydroxybenzoate (PubChem CID 2537018) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is (2-oxo-2-piperidin-1-ylethyl) 2,4-dihydroxybenzoate.
| Compound Name | (2-oxo-2-piperidin-1-ylethyl) 2,4-dihydroxybenzoate |
|---|---|
| PubChem CID | 2537018 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | (2-oxo-2-piperidin-1-ylethyl) 2,4-dihydroxybenzoate |
| SMILES | O=C(OCC(=O)N1CCCCC1)c1ccc(O)cc1O |
| InChI | InChI=1S/C14H17NO5/c16-10-4-5-11(12(17)8-10)14(19)20-9-13(18)15-6-2-1-3-7-15/h4-5,8,16-17H,1-3,6-7,9H2 |
| InChIKey | AHFDDKIQWKKTLO-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |