C15H17Cl2NO3 — CID 23791825
[2-(azepan-1-yl)-2-oxoethyl] 2,4-dichlorobenzoate (PubChem CID 23791825) has the molecular formula C15H17Cl2NO3 and a molecular weight of 330.21 g/mol. Its IUPAC name is [2-(azepan-1-yl)-2-oxoethyl] 2,4-dichlorobenzoate.
| Compound Name | [2-(azepan-1-yl)-2-oxoethyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 23791825 |
| Molecular Formula | C15H17Cl2NO3 |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | [2-(azepan-1-yl)-2-oxoethyl] 2,4-dichlorobenzoate |
| SMILES | O=C(OCC(=O)N1CCCCCC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H17Cl2NO3/c16-11-5-6-12(13(17)9-11)15(20)21-10-14(19)18-7-3-1-2-4-8-18/h5-6,9H,1-4,7-8,10H2 |
| InChIKey | KOAFUVDFSFISMH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |