C19H19ClN2O4 — CID 7990421
[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl] 4-chloro-2-hydroxybenzoate (PubChem CID 7990421) has the molecular formula C19H19ClN2O4 and a molecular weight of 374.82 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylpiperazin-1-yl)ethyl] 4-chloro-2-hydroxybenzoate.
| Compound Name | [2-oxo-2-(4-phenylpiperazin-1-yl)ethyl] 4-chloro-2-hydroxybenzoate |
|---|---|
| PubChem CID | 7990421 |
| Molecular Formula | C19H19ClN2O4 |
| Molecular Weight | 374.82 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | [2-oxo-2-(4-phenylpiperazin-1-yl)ethyl] 4-chloro-2-hydroxybenzoate |
| SMILES | O=C(OCC(=O)N1CCN(c2ccccc2)CC1)c1ccc(Cl)cc1O |
| InChI | InChI=1S/C19H19ClN2O4/c20-14-6-7-16(17(23)12-14)19(25)26-13-18(24)22-10-8-21(9-11-22)15-4-2-1-3-5-15/h1-7,12,23H,8-11,13H2 |
| InChIKey | FWDGCDAZOZFJQV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.82 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |