C19H16Cl3FN2O3 — CID 55403110
[2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl] 2,4-dichloro-5-fluorobenzoate (PubChem CID 55403110) has the molecular formula C19H16Cl3FN2O3 and a molecular weight of 445.71 g/mol. Its IUPAC name is [2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl] 2,4-dichloro-5-fluorobenzoate.
| Compound Name | [2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl] 2,4-dichloro-5-fluorobenzoate |
|---|---|
| PubChem CID | 55403110 |
| Molecular Formula | C19H16Cl3FN2O3 |
| Molecular Weight | 445.71 g/mol |
| Exact Mass | 444.02 |
| IUPAC Name | [2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl] 2,4-dichloro-5-fluorobenzoate |
| SMILES | O=C(OCC(=O)N1CCN(c2cccc(Cl)c2)CC1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C19H16Cl3FN2O3/c20-12-2-1-3-13(8-12)24-4-6-25(7-5-24)18(26)11-28-19(27)14-9-17(23)16(22)10-15(14)21/h1-3,8-10H,4-7,11H2 |
| InChIKey | KMSBPVRFWZCQNX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.71 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|