C20H17ClF3N3O5 — CID 34121265
[2-oxo-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl] 2-chloro-5-nitrobenzoate (PubChem CID 34121265) has the molecular formula C20H17ClF3N3O5 and a molecular weight of 471.82 g/mol. Its IUPAC name is [2-oxo-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl] 2-chloro-5-nitrobenzoate.
| Compound Name | [2-oxo-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl] 2-chloro-5-nitrobenzoate |
|---|---|
| PubChem CID | 34121265 |
| Molecular Formula | C20H17ClF3N3O5 |
| Molecular Weight | 471.82 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | [2-oxo-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl] 2-chloro-5-nitrobenzoate |
| SMILES | O=C(OCC(=O)N1CCN(c2cccc(C(F)(F)F)c2)CC1)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C20H17ClF3N3O5/c21-17-5-4-15(27(30)31)11-16(17)19(29)32-12-18(28)26-8-6-25(7-9-26)14-3-1-2-13(10-14)20(22,23)24/h1-5,10-11H,6-9,12H2 |
| InChIKey | FUNCYFHRTGYLEQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.82 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|