C18H17F3N2O3S — CID 55397091
[2-oxo-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl] thiophene-2-carboxylate (PubChem CID 55397091) has the molecular formula C18H17F3N2O3S and a molecular weight of 398.41 g/mol. Its IUPAC name is [2-oxo-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl] thiophene-2-carboxylate.
| Compound Name | [2-oxo-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 55397091 |
| Molecular Formula | C18H17F3N2O3S |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | [2-oxo-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl] thiophene-2-carboxylate |
| SMILES | O=C(OCC(=O)N1CCN(c2cccc(C(F)(F)F)c2)CC1)c1cccs1 |
| InChI | InChI=1S/C18H17F3N2O3S/c19-18(20,21)13-3-1-4-14(11-13)22-6-8-23(9-7-22)16(24)12-26-17(25)15-5-2-10-27-15/h1-5,10-11H,6-9,12H2 |
| InChIKey | FITPUUHBBBGIGY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |