C19H21F3N4O2S — CID 47017346
[3-oxo-1-thiophen-2-yl-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]urea (PubChem CID 47017346) has the molecular formula C19H21F3N4O2S and a molecular weight of 426.46 g/mol. Its IUPAC name is [3-oxo-1-thiophen-2-yl-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]urea.
| Compound Name | [3-oxo-1-thiophen-2-yl-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]urea |
|---|---|
| PubChem CID | 47017346 |
| Molecular Formula | C19H21F3N4O2S |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | [3-oxo-1-thiophen-2-yl-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]urea |
| SMILES | NC(=O)NC(CC(=O)N1CCN(c2cccc(C(F)(F)F)c2)CC1)c1cccs1 |
| InChI | InChI=1S/C19H21F3N4O2S/c20-19(21,22)13-3-1-4-14(11-13)25-6-8-26(9-7-25)17(27)12-15(24-18(23)28)16-5-2-10-29-16/h1-5,10-11,15H,6-9,12H2,(H3,23,24,28) |
| InChIKey | FDPKZBIBPLFVMM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |