C17H23F3N4O2 — CID 51968388
[(2S)-3-methyl-1-oxo-1-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butan-2-yl]urea (PubChem CID 51968388) has the molecular formula C17H23F3N4O2 and a molecular weight of 372.39 g/mol. Its IUPAC name is [(2S)-3-methyl-1-oxo-1-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butan-2-yl]urea.
| Compound Name | [(2S)-3-methyl-1-oxo-1-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butan-2-yl]urea |
|---|---|
| PubChem CID | 51968388 |
| Molecular Formula | C17H23F3N4O2 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | [(2S)-3-methyl-1-oxo-1-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butan-2-yl]urea |
| SMILES | CC(C)[C@H](NC(N)=O)C(=O)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C17H23F3N4O2/c1-11(2)14(22-16(21)26)15(25)24-8-6-23(7-9-24)13-5-3-4-12(10-13)17(18,19)20/h3-5,10-11,14H,6-9H2,1-2H3,(H3,21,22,26)/t14-/m0/s1 |
| InChIKey | RELHRQJPQOEKML-AWEZNQCLSA-N |
| XLogP | 2.05 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |