C21H23F3N2O — CID 78769873
3-phenyl-1-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butan-1-one (PubChem CID 78769873) has the molecular formula C21H23F3N2O and a molecular weight of 376.42 g/mol. Its IUPAC name is 3-phenyl-1-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butan-1-one.
| Compound Name | 3-phenyl-1-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 78769873 |
| Molecular Formula | C21H23F3N2O |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 3-phenyl-1-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butan-1-one |
| SMILES | CC(CC(=O)N1CCN(c2cccc(C(F)(F)F)c2)CC1)c1ccccc1 |
| InChI | InChI=1S/C21H23F3N2O/c1-16(17-6-3-2-4-7-17)14-20(27)26-12-10-25(11-13-26)19-9-5-8-18(15-19)21(22,23)24/h2-9,15-16H,10-14H2,1H3 |
| InChIKey | SZWSLJNFSAPSNC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |