C15H18ClF3N2O — CID 5222838
4-chloro-1-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butan-1-one (PubChem CID 5222838) has the molecular formula C15H18ClF3N2O and a molecular weight of 334.77 g/mol. Its IUPAC name is 4-chloro-1-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butan-1-one.
| Compound Name | 4-chloro-1-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 5222838 |
| Molecular Formula | C15H18ClF3N2O |
| Molecular Weight | 334.77 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 4-chloro-1-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butan-1-one |
| SMILES | O=C(CCCCl)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C15H18ClF3N2O/c16-6-2-5-14(22)21-9-7-20(8-10-21)13-4-1-3-12(11-13)15(17,18)19/h1,3-4,11H,2,5-10H2 |
| InChIKey | YUHQFXLEXHALSJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.77 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|