C18H22F3N3OS2 — CID 60599399
[2-oxo-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl] pyrrolidine-1-carbodithioate (PubChem CID 60599399) has the molecular formula C18H22F3N3OS2 and a molecular weight of 417.52 g/mol. Its IUPAC name is [2-oxo-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl] pyrrolidine-1-carbodithioate.
| Compound Name | [2-oxo-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 60599399 |
| Molecular Formula | C18H22F3N3OS2 |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | [2-oxo-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl] pyrrolidine-1-carbodithioate |
| SMILES | O=C(CSC(=S)N1CCCC1)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C18H22F3N3OS2/c19-18(20,21)14-4-3-5-15(12-14)22-8-10-23(11-9-22)16(25)13-27-17(26)24-6-1-2-7-24/h3-5,12H,1-2,6-11,13H2 |
| InChIKey | BJAYNYLKZIKBSQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|