C23H24F3N3O3 — CID 4608305
4-[2-oxo-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione (PubChem CID 4608305) has the molecular formula C23H24F3N3O3 and a molecular weight of 447.46 g/mol. Its IUPAC name is 4-[2-oxo-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione.
| Compound Name | 4-[2-oxo-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 4608305 |
| Molecular Formula | C23H24F3N3O3 |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 4-[2-oxo-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
| SMILES | O=C(CN1C(=O)C2C3C=CC(CC3)C2C1=O)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C23H24F3N3O3/c24-23(25,26)16-2-1-3-17(12-16)27-8-10-28(11-9-27)18(30)13-29-21(31)19-14-4-5-15(7-6-14)20(19)22(29)32/h1-5,12,14-15,19-20H,6-11,13H2 |
| InChIKey | PIGHQLXEYAMXLD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|