C26H34F3N3O2 — CID 14086524
4-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-4-azatricyclo[5.3.2.02,6]dodecane-3,5-dione (PubChem CID 14086524) has the molecular formula C26H34F3N3O2 and a molecular weight of 477.57 g/mol. Its IUPAC name is 4-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-4-azatricyclo[5.3.2.02,6]dodecane-3,5-dione.
| Compound Name | 4-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-4-azatricyclo[5.3.2.02,6]dodecane-3,5-dione |
|---|---|
| PubChem CID | 14086524 |
| Molecular Formula | C26H34F3N3O2 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | 4-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-4-azatricyclo[5.3.2.02,6]dodecane-3,5-dione |
| SMILES | O=C1C2C3CCCC(CC3)C2C(=O)N1CCCCN1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C26H34F3N3O2/c27-26(28,29)20-7-4-8-21(17-20)31-15-13-30(14-16-31)11-1-2-12-32-24(33)22-18-5-3-6-19(10-9-18)23(22)25(32)34/h4,7-8,17-19,22-23H,1-3,5-6,9-16H2 |
| InChIKey | SBJVGEUWCALWNH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|