C25H34F3N5O — CID 112837949
2-(1-methylpyrrol-2-yl)-N-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]pyrrolidine-1-carboxamide (PubChem CID 112837949) has the molecular formula C25H34F3N5O and a molecular weight of 477.58 g/mol. Its IUPAC name is 2-(1-methylpyrrol-2-yl)-N-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]pyrrolidine-1-carboxamide.
| Compound Name | 2-(1-methylpyrrol-2-yl)-N-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 112837949 |
| Molecular Formula | C25H34F3N5O |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.27 |
| IUPAC Name | 2-(1-methylpyrrol-2-yl)-N-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]pyrrolidine-1-carboxamide |
| SMILES | Cn1cccc1C1CCCN1C(=O)NCCCCN1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C25H34F3N5O/c1-30-12-5-9-22(30)23-10-6-14-33(23)24(34)29-11-2-3-13-31-15-17-32(18-16-31)21-8-4-7-20(19-21)25(26,27)28/h4-5,7-9,12,19,23H,2-3,6,10-11,13-18H2,1H3,(H,29,34) |
| InChIKey | DWGCBKFUYSQNSB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 43.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|