C22H28F3N5O2 — CID 112841508
3,4-dimethyl-6-oxo-N-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-1H-pyridazine-5-carboxamide (PubChem CID 112841508) has the molecular formula C22H28F3N5O2 and a molecular weight of 451.49 g/mol. Its IUPAC name is 3,4-dimethyl-6-oxo-N-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-1H-pyridazine-5-carboxamide.
| Compound Name | 3,4-dimethyl-6-oxo-N-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-1H-pyridazine-5-carboxamide |
|---|---|
| PubChem CID | 112841508 |
| Molecular Formula | C22H28F3N5O2 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | 3,4-dimethyl-6-oxo-N-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-1H-pyridazine-5-carboxamide |
| SMILES | Cc1n[nH]c(=O)c(C(=O)NCCCCN2CCN(c3cccc(C(F)(F)F)c3)CC2)c1C |
| InChI | InChI=1S/C22H28F3N5O2/c1-15-16(2)27-28-21(32)19(15)20(31)26-8-3-4-9-29-10-12-30(13-11-29)18-7-5-6-17(14-18)22(23,24)25/h5-7,14H,3-4,8-13H2,1-2H3,(H,26,31)(H,28,32) |
| InChIKey | UQUJACFLPRBDGU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|