C18H22F3N5O — CID 47055405
N-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]-1H-pyrazole-5-carboxamide (PubChem CID 47055405) has the molecular formula C18H22F3N5O and a molecular weight of 381.40 g/mol. Its IUPAC name is N-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 47055405 |
| Molecular Formula | C18H22F3N5O |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | N-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NCCCN1CCN(c2cccc(C(F)(F)F)c2)CC1)c1ccn[nH]1 |
| InChI | InChI=1S/C18H22F3N5O/c19-18(20,21)14-3-1-4-15(13-14)26-11-9-25(10-12-26)8-2-6-22-17(27)16-5-7-23-24-16/h1,3-5,7,13H,2,6,8-12H2,(H,22,27)(H,23,24) |
| InChIKey | IKVBMZXUEPYQGO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|