C24H30F3N3O — CID 71942240
3-(3-methylphenyl)-N-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]propanamide (PubChem CID 71942240) has the molecular formula C24H30F3N3O and a molecular weight of 433.52 g/mol. Its IUPAC name is 3-(3-methylphenyl)-N-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]propanamide.
| Compound Name | 3-(3-methylphenyl)-N-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]propanamide |
|---|---|
| PubChem CID | 71942240 |
| Molecular Formula | C24H30F3N3O |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | 3-(3-methylphenyl)-N-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]propanamide |
| SMILES | Cc1cccc(CCC(=O)NCCCN2CCN(c3cccc(C(F)(F)F)c3)CC2)c1 |
| InChI | InChI=1S/C24H30F3N3O/c1-19-5-2-6-20(17-19)9-10-23(31)28-11-4-12-29-13-15-30(16-14-29)22-8-3-7-21(18-22)24(25,26)27/h2-3,5-8,17-18H,4,9-16H2,1H3,(H,28,31) |
| InChIKey | UKPDGJRIMFWSHE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|