C24H32ClN3O — CID 55662231
3-(3-chlorophenyl)-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]propanamide (PubChem CID 55662231) has the molecular formula C24H32ClN3O and a molecular weight of 413.99 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]propanamide.
| Compound Name | 3-(3-chlorophenyl)-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]propanamide |
|---|---|
| PubChem CID | 55662231 |
| Molecular Formula | C24H32ClN3O |
| Molecular Weight | 413.99 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 3-(3-chlorophenyl)-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]propanamide |
| SMILES | Cc1cccc(N2CCN(CCCCNC(=O)CCc3cccc(Cl)c3)CC2)c1 |
| InChI | InChI=1S/C24H32ClN3O/c1-20-6-4-9-23(18-20)28-16-14-27(15-17-28)13-3-2-12-26-24(29)11-10-21-7-5-8-22(25)19-21/h4-9,18-19H,2-3,10-17H2,1H3,(H,26,29) |
| InChIKey | OIZICXNRORZZBD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.99 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|