C24H33N3O — CID 86981700
2,5-dimethyl-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]benzamide (PubChem CID 86981700) has the molecular formula C24H33N3O and a molecular weight of 379.55 g/mol. Its IUPAC name is 2,5-dimethyl-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]benzamide.
| Compound Name | 2,5-dimethyl-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]benzamide |
|---|---|
| PubChem CID | 86981700 |
| Molecular Formula | C24H33N3O |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.26 |
| IUPAC Name | 2,5-dimethyl-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]benzamide |
| SMILES | Cc1cccc(N2CCN(CCCCNC(=O)c3cc(C)ccc3C)CC2)c1 |
| InChI | InChI=1S/C24H33N3O/c1-19-7-6-8-22(17-19)27-15-13-26(14-16-27)12-5-4-11-25-24(28)23-18-20(2)9-10-21(23)3/h6-10,17-18H,4-5,11-16H2,1-3H3,(H,25,28) |
| InChIKey | XRBXAUKFADQHHA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|