C26H34N4O — CID 161383648
methane;N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]quinoline-2-carboxamide (PubChem CID 161383648) has the molecular formula C26H34N4O and a molecular weight of 418.59 g/mol. Its IUPAC name is methane;N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]quinoline-2-carboxamide.
| Compound Name | methane;N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 161383648 |
| Molecular Formula | C26H34N4O |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | methane;N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]quinoline-2-carboxamide |
| SMILES | C.Cc1cccc(N2CCN(CCCCNC(=O)c3ccc4ccccc4n3)CC2)c1 |
| InChI | InChI=1S/C25H30N4O.CH4/c1-20-7-6-9-22(19-20)29-17-15-28(16-18-29)14-5-4-13-26-25(30)24-12-11-21-8-2-3-10-23(21)27-24;/h2-3,6-12,19H,4-5,13-18H2,1H3,(H,26,30);1H4 |
| InChIKey | VSAXUGKREJWOMF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|