C18H24N4O — CID 51073449
N-[3-(4-methylpiperazin-1-yl)propyl]quinoline-2-carboxamide (PubChem CID 51073449) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is N-[3-(4-methylpiperazin-1-yl)propyl]quinoline-2-carboxamide.
| Compound Name | N-[3-(4-methylpiperazin-1-yl)propyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 51073449 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | N-[3-(4-methylpiperazin-1-yl)propyl]quinoline-2-carboxamide |
| SMILES | CN1CCN(CCCNC(=O)c2ccc3ccccc3n2)CC1 |
| InChI | InChI=1S/C18H24N4O/c1-21-11-13-22(14-12-21)10-4-9-19-18(23)17-8-7-15-5-2-3-6-16(15)20-17/h2-3,5-8H,4,9-14H2,1H3,(H,19,23) |
| InChIKey | ORPFCRIYRCKJKO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|