C30H34N4O2S2 — CID 56642778
N-[5-[5-(quinoline-2-carbonylamino)pentyldisulfanyl]pentyl]quinoline-2-carboxamide (PubChem CID 56642778) has the molecular formula C30H34N4O2S2 and a molecular weight of 546.76 g/mol. Its IUPAC name is N-[5-[5-(quinoline-2-carbonylamino)pentyldisulfanyl]pentyl]quinoline-2-carboxamide.
| Compound Name | N-[5-[5-(quinoline-2-carbonylamino)pentyldisulfanyl]pentyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 56642778 |
| Molecular Formula | C30H34N4O2S2 |
| Molecular Weight | 546.76 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | N-[5-[5-(quinoline-2-carbonylamino)pentyldisulfanyl]pentyl]quinoline-2-carboxamide |
| SMILES | O=C(NCCCCCSSCCCCCNC(=O)c1ccc2ccccc2n1)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C30H34N4O2S2/c35-29(27-17-15-23-11-3-5-13-25(23)33-27)31-19-7-1-9-21-37-38-22-10-2-8-20-32-30(36)28-18-16-24-12-4-6-14-26(24)34-28/h3-6,11-18H,1-2,7-10,19-22H2,(H,31,35)(H,32,36) |
| InChIKey | PIMJKHFMZCVCSB-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.76 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|