C14H14N2O4 — CID 66173370
2-hydroxy-2-methyl-3-(quinoline-2-carbonylamino)propanoic acid (PubChem CID 66173370) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-3-(quinoline-2-carbonylamino)propanoic acid.
| Compound Name | 2-hydroxy-2-methyl-3-(quinoline-2-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 66173370 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 2-hydroxy-2-methyl-3-(quinoline-2-carbonylamino)propanoic acid |
| SMILES | CC(O)(CNC(=O)c1ccc2ccccc2n1)C(=O)O |
| InChI | InChI=1S/C14H14N2O4/c1-14(20,13(18)19)8-15-12(17)11-7-6-9-4-2-3-5-10(9)16-11/h2-7,20H,8H2,1H3,(H,15,17)(H,18,19) |
| InChIKey | LXPDXXTZTIODHZ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |