C7H9N3O4S — CID 66174400
2-hydroxy-2-methyl-3-(thiadiazole-4-carbonylamino)propanoic acid (PubChem CID 66174400) has the molecular formula C7H9N3O4S and a molecular weight of 231.23 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-3-(thiadiazole-4-carbonylamino)propanoic acid.
| Compound Name | 2-hydroxy-2-methyl-3-(thiadiazole-4-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 66174400 |
| Molecular Formula | C7H9N3O4S |
| Molecular Weight | 231.23 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 2-hydroxy-2-methyl-3-(thiadiazole-4-carbonylamino)propanoic acid |
| SMILES | CC(O)(CNC(=O)c1csnn1)C(=O)O |
| InChI | InChI=1S/C7H9N3O4S/c1-7(14,6(12)13)3-8-5(11)4-2-15-10-9-4/h2,14H,3H2,1H3,(H,8,11)(H,12,13) |
| InChIKey | VLXRJODECTZFEN-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.23 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |