C8H14N4O2S — CID 82993492
N-[2-(2-methoxyethylamino)ethyl]thiadiazole-4-carboxamide (PubChem CID 82993492) has the molecular formula C8H14N4O2S and a molecular weight of 230.29 g/mol. Its IUPAC name is N-[2-(2-methoxyethylamino)ethyl]thiadiazole-4-carboxamide.
| Compound Name | N-[2-(2-methoxyethylamino)ethyl]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 82993492 |
| Molecular Formula | C8H14N4O2S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | N-[2-(2-methoxyethylamino)ethyl]thiadiazole-4-carboxamide |
| SMILES | COCCNCCNC(=O)c1csnn1 |
| InChI | InChI=1S/C8H14N4O2S/c1-14-5-4-9-2-3-10-8(13)7-6-15-12-11-7/h6,9H,2-5H2,1H3,(H,10,13) |
| InChIKey | IVTYKGAKDXVCTA-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|