C10H8Cl2N4O2S — CID 71917382
N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]thiadiazole-4-carboxamide (PubChem CID 71917382) has the molecular formula C10H8Cl2N4O2S and a molecular weight of 319.17 g/mol. Its IUPAC name is N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]thiadiazole-4-carboxamide.
| Compound Name | N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 71917382 |
| Molecular Formula | C10H8Cl2N4O2S |
| Molecular Weight | 319.17 g/mol |
| Exact Mass | 317.97 |
| IUPAC Name | N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]thiadiazole-4-carboxamide |
| SMILES | O=C(NCCOc1ncc(Cl)cc1Cl)c1csnn1 |
| InChI | InChI=1S/C10H8Cl2N4O2S/c11-6-3-7(12)10(14-4-6)18-2-1-13-9(17)8-5-19-16-15-8/h3-5H,1-2H2,(H,13,17) |
| InChIKey | WBYSFJLITAHAHY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.17 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|