C15H11Cl2F3N2O2 — CID 74766847
N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]-2-(trifluoromethyl)benzamide (PubChem CID 74766847) has the molecular formula C15H11Cl2F3N2O2 and a molecular weight of 379.17 g/mol. Its IUPAC name is N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 74766847 |
| Molecular Formula | C15H11Cl2F3N2O2 |
| Molecular Weight | 379.17 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]-2-(trifluoromethyl)benzamide |
| SMILES | O=C(NCCOc1ncc(Cl)cc1Cl)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H11Cl2F3N2O2/c16-9-7-12(17)14(22-8-9)24-6-5-21-13(23)10-3-1-2-4-11(10)15(18,19)20/h1-4,7-8H,5-6H2,(H,21,23) |
| InChIKey | HRXFRKHLTYFDBS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.17 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|