C16H12ClF6N3O — CID 27888731
N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-2-(trifluoromethyl)benzamide (PubChem CID 27888731) has the molecular formula C16H12ClF6N3O and a molecular weight of 411.73 g/mol. Its IUPAC name is N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 27888731 |
| Molecular Formula | C16H12ClF6N3O |
| Molecular Weight | 411.73 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-2-(trifluoromethyl)benzamide |
| SMILES | O=C(NCCNc1ncc(C(F)(F)F)cc1Cl)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H12ClF6N3O/c17-12-7-9(15(18,19)20)8-26-13(12)24-5-6-25-14(27)10-3-1-2-4-11(10)16(21,22)23/h1-4,7-8H,5-6H2,(H,24,26)(H,25,27) |
| InChIKey | FOPQGYWEYXLJDN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.73 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|