C15H12ClF3IN3O — CID 26373720
N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-2-iodobenzamide (PubChem CID 26373720) has the molecular formula C15H12ClF3IN3O and a molecular weight of 469.63 g/mol. Its IUPAC name is N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-2-iodobenzamide.
| Compound Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 26373720 |
| Molecular Formula | C15H12ClF3IN3O |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 468.97 |
| IUPAC Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-2-iodobenzamide |
| SMILES | O=C(NCCNc1ncc(C(F)(F)F)cc1Cl)c1ccccc1I |
| InChI | InChI=1S/C15H12ClF3IN3O/c16-11-7-9(15(17,18)19)8-23-13(11)21-5-6-22-14(24)10-3-1-2-4-12(10)20/h1-4,7-8H,5-6H2,(H,21,23)(H,22,24) |
| InChIKey | JFTJCKSXYAEZAD-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|