C17H15Cl2F3N4O2 — CID 27888885
2-chloro-N-[2-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]-2-oxoethyl]benzamide (PubChem CID 27888885) has the molecular formula C17H15Cl2F3N4O2 and a molecular weight of 435.23 g/mol. Its IUPAC name is 2-chloro-N-[2-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]-2-oxoethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 27888885 |
| Molecular Formula | C17H15Cl2F3N4O2 |
| Molecular Weight | 435.23 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | 2-chloro-N-[2-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1Cl)NCCNc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C17H15Cl2F3N4O2/c18-12-4-2-1-3-11(12)16(28)26-9-14(27)23-5-6-24-15-13(19)7-10(8-25-15)17(20,21)22/h1-4,7-8H,5-6,9H2,(H,23,27)(H,24,25)(H,26,28) |
| InChIKey | CIVFZEOFPQEPPY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.23 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|