C15H12ClF3N6O — CID 32642523
N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-2H-benzotriazole-5-carboxamide (PubChem CID 32642523) has the molecular formula C15H12ClF3N6O and a molecular weight of 384.75 g/mol. Its IUPAC name is N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-2H-benzotriazole-5-carboxamide.
| Compound Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-2H-benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 32642523 |
| Molecular Formula | C15H12ClF3N6O |
| Molecular Weight | 384.75 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-2H-benzotriazole-5-carboxamide |
| SMILES | O=C(NCCNc1ncc(C(F)(F)F)cc1Cl)c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C15H12ClF3N6O/c16-10-6-9(15(17,18)19)7-22-13(10)20-3-4-21-14(26)8-1-2-11-12(5-8)24-25-23-11/h1-2,5-7H,3-4H2,(H,20,22)(H,21,26)(H,23,24,25) |
| InChIKey | VCMZWLPQOLDAHA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.75 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|