C20H22ClF3N4O3S — CID 46592275
N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 46592275) has the molecular formula C20H22ClF3N4O3S and a molecular weight of 490.94 g/mol. Its IUPAC name is N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 46592275 |
| Molecular Formula | C20H22ClF3N4O3S |
| Molecular Weight | 490.94 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(NCCNc1ncc(C(F)(F)F)cc1Cl)c1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C20H22ClF3N4O3S/c21-17-12-15(20(22,23)24)13-27-18(17)25-7-8-26-19(29)14-5-4-6-16(11-14)32(30,31)28-9-2-1-3-10-28/h4-6,11-13H,1-3,7-10H2,(H,25,27)(H,26,29) |
| InChIKey | UDMVUOARNXZHDA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.94 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|