C20H24N4O5S — CID 41262654
N-[2-(4-nitroanilino)ethyl]-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 41262654) has the molecular formula C20H24N4O5S and a molecular weight of 432.50 g/mol. Its IUPAC name is N-[2-(4-nitroanilino)ethyl]-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[2-(4-nitroanilino)ethyl]-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 41262654 |
| Molecular Formula | C20H24N4O5S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | N-[2-(4-nitroanilino)ethyl]-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(NCCNc1ccc([N+](=O)[O-])cc1)c1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C20H24N4O5S/c25-20(22-12-11-21-17-7-9-18(10-8-17)24(26)27)16-5-4-6-19(15-16)30(28,29)23-13-2-1-3-14-23/h4-10,15,21H,1-3,11-14H2,(H,22,25) |
| InChIKey | NZFFCLNDFQBNKH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|