C19H20N4O7S — CID 13098766
N-[3-(azepan-1-ylsulfonyl)phenyl]-3,5-dinitrobenzamide (PubChem CID 13098766) has the molecular formula C19H20N4O7S and a molecular weight of 448.46 g/mol. Its IUPAC name is N-[3-(azepan-1-ylsulfonyl)phenyl]-3,5-dinitrobenzamide.
| Compound Name | N-[3-(azepan-1-ylsulfonyl)phenyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 13098766 |
| Molecular Formula | C19H20N4O7S |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | N-[3-(azepan-1-ylsulfonyl)phenyl]-3,5-dinitrobenzamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)N2CCCCCC2)c1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H20N4O7S/c24-19(14-10-16(22(25)26)13-17(11-14)23(27)28)20-15-6-5-7-18(12-15)31(29,30)21-8-3-1-2-4-9-21/h5-7,10-13H,1-4,8-9H2,(H,20,24) |
| InChIKey | LPHABZBFYHKXQQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|